For research use only. Not for therapeutic Use.
BIIB 021(Cat No.:I005088)is a potent and selective inhibitor of heat shock protein 90 (Hsp90), a molecular chaperone that stabilizes and activates various client proteins involved in cancer cell growth and survival. By inhibiting Hsp90, BIIB 021 promotes the degradation of these client proteins, leading to the disruption of multiple oncogenic pathways, cell cycle arrest, and apoptosis in cancer cells. BIIB 021 has demonstrated efficacy in preclinical and clinical studies for treating various cancers, including breast and lung cancers. Its targeted mechanism makes it a promising candidate for cancer therapy.
CAS Number | 848695-25-0 |
Synonyms | 6-chloro-9-[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]purin-2-amine |
Molecular Formula | C₁₄H₁₅ClN₆O |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | DMSO: ≥ 45 mg/mL |
Storage | 3 years -20℃ powder |
IC50 | 1.7 nM(Ki) |
IUPAC Name | 6-chloro-9-[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]purin-2-amine |
InChI | InChI=1S/C14H15ClN6O/c1-7-4-17-9(8(2)11(7)22-3)5-21-6-18-10-12(15)19-14(16)20-13(10)21/h4,6H,5H2,1-3H3,(H2,16,19,20) |
InChIKey | QULDDKSCVCJTPV-UHFFFAOYSA-N |
SMILES | CC1=CN=C(C(=C1OC)C)CN2C=NC3=C2N=C(N=C3Cl)N |
Reference | <p style=/line-height:25px/> |