For research use only. Not for therapeutic Use.
Bimatoprost-d5（Cat No.:S000382） is a deuterated variant of bimatoprost, where five hydrogen atoms are replaced with deuterium. Bimatoprost is a prostaglandin analog used primarily to treat glaucoma and ocular hypertension by increasing the outflow of aqueous fluid from the eyes, thereby reducing intraocular pressure. The introduction of deuterium into bimatoprost enhances the stability of the molecule and facilitates detailed pharmacokinetic and metabolic studies.
| Catalog Number | S000382 |
| Molecular Formula | C25H32D5NO4 |
| Purity | ≥95% |
| Target | Prostaglandin Receptor |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]-N-(1,1,2,2,2-pentadeuterioethyl)hept-5-enamide |
| InChI | InChI=1S/C25H37NO4/c1-2-26-25(30)13-9-4-3-8-12-21-22(24(29)18-23(21)28)17-16-20(27)15-14-19-10-6-5-7-11-19/h3,5-8,10-11,16-17,20-24,27-29H,2,4,9,12-15,18H2,1H3,(H,26,30)/b8-3-,17-16+/t20-,21+,22+,23-,24+/m0/s1/i1D3,2D2 |
| InChIKey | AQOKCDNYWBIDND-FNXJMACCSA-N |
| SMILES | CCNC(=O)CCCC=CCC1C(CC(C1C=CC(CCC2=CC=CC=C2)O)O)O |
