For research use only. Not for therapeutic Use.
Bimoclomol is a small-molecule heat shock protein (HSP) co-inducer with potential therapeutic applications in neurodegenerative diseases and diabetes. By enhancing the body’s natural stress response through the upregulation of HSPs, bimoclomol helps protect cells from damage caused by oxidative stress, inflammation, and protein misfolding. Its unique mechanism of action makes it valuable in treating conditions like amyotrophic lateral sclerosis (ALS) and diabetic complications. Bimoclomol’s ability to modulate cellular defense systems offers promise for innovative therapeutic strategies.
| Catalog Number | M112389 |
| CAS Number | 130493-03-7 |
| Synonyms | (3Z)-N-(2-hydroxy-3-piperidin-1-ylpropoxy)pyridine-3-carboximidoyl chloride |
| Molecular Formula | C14H20ClN3O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C14H20ClN3O2/c15-14(12-5-4-6-16-9-12)17-20-11-13(19)10-18-7-2-1-3-8-18/h4-6,9,13,19H,1-3,7-8,10-11H2/b17-14- |
| InChIKey | NMOVJBAGBXIKCG-VKAVYKQESA-N |
| SMILES | C1CCN(CC1)CC(CON=C(C2=CN=CC=C2)Cl)O |
