For research use only. Not for therapeutic Use.
Binapo (CAS 94041-18-6), or (S)-BINAP-Oxide (Cat.No:L003479), is a crucial chiral ligand in asymmetric catalysis. Its unique structure imparts exceptional stereochemical control in various chemical reactions, making it invaluable in the synthesis of pharmaceuticals and fine chemicals. This ligand has played a pivotal role in advancing asymmetric synthesis methodologies, earning it a prominent place in the toolkit of modern organic chemists.
CAS Number | 94041-18-6 |
Molecular Formula | C44H32O2P2 |
Purity | ≥95% |
IUPAC Name | 2-diphenylphosphoryl-1-(2-diphenylphosphorylnaphthalen-1-yl)naphthalene |
InChI | InChI=1S/C44H32O2P2/c45-47(35-19-5-1-6-20-35,36-21-7-2-8-22-36)41-31-29-33-17-13-15-27-39(33)43(41)44-40-28-16-14-18-34(40)30-32-42(44)48(46,37-23-9-3-10-24-37)38-25-11-4-12-26-38/h1-32H |
InChIKey | SEZSRPYCOMAEDL-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(=O)(C7=CC=CC=C7)C8=CC=CC=C8 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |