For research use only. Not for therapeutic Use.
Biocytin hydrazide（Cat No.:M001727）is a biotinylated derivative used in various biochemical applications, particularly in protein labeling and detection. It consists of biocytin, a form of biotin (vitamin B7), which is covalently attached to a hydrazide group. This modification allows for specific binding to biomolecules, such as proteins or antibodies, enabling their detection and quantification in assays. Biocytin hydrazide is commonly employed in studies involving protein-protein interactions, enzyme activity, and immunohistochemistry. Its ability to bind to avidin or streptavidin makes it valuable in research areas like molecular biology, diagnostics, and drug development.
| CAS Number | 102743-85-1 |
| Synonyms | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[(5S)-5-amino-6-hydrazinyl-6-oxohexyl]pentanamide |
| Molecular Formula | C16H30N6O3S |
| Purity | ≥95% |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[(5S)-5-amino-6-hydrazinyl-6-oxohexyl]pentanamide |
| InChI | InChI=1S/C16H30N6O3S/c17-10(15(24)22-18)5-3-4-8-19-13(23)7-2-1-6-12-14-11(9-26-12)20-16(25)21-14/h10-12,14H,1-9,17-18H2,(H,19,23)(H,22,24)(H2,20,21,25)/t10-,11-,12-,14-/m0/s1 |
| InChIKey | XSXHTPJCSHZYFJ-MNXVOIDGSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCCC[C@@H](C(=O)NN)N)NC(=O)N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
