For research use only. Not for therapeutic Use.
Biotin-d2-1(Cat No.:S000554) is a specialized form of biotin, also known as vitamin B7 or vitamin H, essential for various metabolic processes including fatty acid synthesis, gluconeogenesis, and amino acid metabolism. The “d2-1” designation indicates that one hydrogen atom in the biotin molecule is replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling facilitates precise tracking of biotin metabolism and its incorporation into biochemical pathways using advanced analytical techniques like mass spectrometry.
Catalog Number | S000554 |
CAS Number | 1217481-41-8 |
Molecular Formula | C10H14D2N2O3S |
Purity | ≥95% |
IUPAC Name | 5-[(3aR,6S,6aS)-4,4-dideuterio-2-oxo-3,3a,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-6-yl]pentanoic acid |
InChI | InChI=1S/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7-,9-/m0/s1/i5D2 |
InChIKey | YBJHBAHKTGYVGT-OXQHWPBHSA-N |
SMILES | C1C2C(C(S1)CCCCC(=O)O)NC(=O)N2 |