For research use only. Not for therapeutic Use.
Biotinyl-NH-PEG3-C3-amido-C3-COOH（Cat No.:I042946）is a bioconjugation reagent used in various biochemical and cell biology applications. This compound features a biotin group for strong binding to streptavidin or avidin, a polyethylene glycol (PEG) linker for enhancing solubility and stability, and an amido group for facilitating conjugation with other molecules. The C3-amido-C3-COOH structure provides flexibility for coupling to proteins, peptides, or other biomolecules, making it useful in applications like protein labeling, drug delivery, or creating biotinylated surfaces for assays. Its design allows efficient and versatile coupling in research and diagnostic applications.
| CAS Number | 1202761-21-4 |
| Synonyms | 5-[3-[2-[2-[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]propylamino]-5-oxopentanoic acid |
| Molecular Formula | C25H44N4O8S |
| Purity | ≥95% |
| IUPAC Name | 5-[3-[2-[2-[3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]propylamino]-5-oxopentanoic acid |
| InChI | InChI=1S/C25H44N4O8S/c30-21(7-2-1-6-20-24-19(18-38-20)28-25(34)29-24)26-10-4-12-35-14-16-37-17-15-36-13-5-11-27-22(31)8-3-9-23(32)33/h19-20,24H,1-18H2,(H,26,30)(H,27,31)(H,32,33)(H2,28,29,34)/t19-,20-,24-/m0/s1 |
| InChIKey | KUWCOOYXVSTSME-SKPFHBQLSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCCOCCOCCOCCCNC(=O)CCCC(=O)O)NC(=O)N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
