For research use only. Not for therapeutic Use.
BIRT 377（Cat No.:R064174）is a small molecule inhibitor that targets Bruton’s tyrosine kinase (BTK), a key enzyme involved in the signaling of B cells and other immune cells. By inhibiting BTK, BIRT 377 disrupts signaling pathways that promote cell proliferation and survival, particularly in B-cell malignancies such as chronic lymphocytic leukemia (CLL) and mantle cell lymphoma. Preclinical studies have demonstrated its potential in reducing tumor growth and improving the efficacy of immune therapies. BIRT 377 is being explored as a promising therapeutic agent for the treatment of B-cell-related cancers and autoimmune disorders.
| CAS Number | 213211-10-0 |
| Synonyms | (5R)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-1,5-dimethylimidazolidine-2,4-dione |
| Molecular Formula | C18H15BrCl2N2O2 |
| Purity | ≥95% |
| IUPAC Name | (5R)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-1,5-dimethylimidazolidine-2,4-dione |
| InChI | InChI=1S/C18H15BrCl2N2O2/c1-18(10-11-3-5-12(19)6-4-11)16(24)23(17(25)22(18)2)15-8-13(20)7-14(21)9-15/h3-9H,10H2,1-2H3/t18-/m1/s1 |
| InChIKey | FJNJHZQMQRVZEE-GOSISDBHSA-N |
| SMILES | C[C@]1(C(=O)N(C(=O)N1C)C2=CC(=CC(=C2)Cl)Cl)CC3=CC=C(C=C3)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
