For research use only. Not for therapeutic Use.
Bis(2,4,4-trimethylpentyl)phosphinic acid(Cat No.:M007994) is a specialized chemical compound featuring a phosphinic acid group linked to two 2,4,4-trimethylpentyl chains. This structure classifies it as a phosphinic acid ester, known for its role as a ligand in coordination chemistry and as an extractant in the hydrometallurgical separation of metals. The bulky trimethylpentyl groups enhance the solubility of the compound in organic solvents, making it effective for use in processes involving the extraction of rare earth elements and transition metals from various matrices. Its application is crucial in the recycling and purification of metals in industrial contexts.
CAS Number | 83411-71-6 |
Synonyms | bis(2,4,4-trimethylpentyl)-phosphinicaci;Bis(2,4,4-trimethylpentyl)phosphinsure;Cyanex 272;Ionquest 290;Phosphinic acid,bis(2,4,4-triMethylpentyl)- |
Molecular Formula | C16H35O2P |
Purity | ≥95% |
Documentation | |
Storage | room temp |
IUPAC Name | bis(2,4,4-trimethylpentyl)phosphinic acid |
InChI | InChI=1S/C16H35O2P/c1-13(9-15(3,4)5)11-19(17,18)12-14(2)10-16(6,7)8/h13-14H,9-12H2,1-8H3,(H,17,18) |
InChIKey | QUXFOKCUIZCKGS-UHFFFAOYSA-N |
SMILES | CC(CC(C)(C)C)CP(=O)(CC(C)CC(C)(C)C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |