For research use only. Not for therapeutic Use.
Bis(4-nitrophenyl) carbonate(Cat No.:R023687)is an organic compound commonly used as a reagent in organic synthesis, particularly in the preparation of urethanes, carbamates, and other carbonyl-containing derivatives. It acts as a carbonylating agent, facilitating the introduction of a carbonate group into molecules, which is crucial in polymer chemistry and the production of pharmaceuticals. Its reactivity with amines makes it valuable for creating protective groups or modifying chemical structures. Due to its versatility, Bis(4-nitrophenyl) carbonate is widely used in research labs for chemical modifications and material science applications.
CAS Number | 5070-13-3 |
Synonyms | Carbonic Acid Bis(4-nitrophenyl) Ester; 4,4’-Dinitrodiphenyl Carbonate; Bis(p-nitrophenyl) Carbonate; Di-4-nitrophenyl Carbonate; Di-p-nitrophenyl Carbonate; NSC 1730; p,p’-Dinitrodiphenylcarbonate; |
Molecular Formula | C13H8N2O7 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | bis(4-nitrophenyl) carbonate |
InChI | InChI=1S/C13H8N2O7/c16-13(21-11-5-1-9(2-6-11)14(17)18)22-12-7-3-10(4-8-12)15(19)20/h1-8H |
InChIKey | ACBQROXDOHKANW-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |