For research use only. Not for therapeutic Use.
Bis(5-oxo-L-prolinato-N1,O2)zinc(CAT: M130055) is a coordination complex composed of zinc and 5-oxo-L-proline ligands, commonly studied in biochemistry and coordination chemistry. In this compound, zinc is coordinated through the nitrogen and oxygen atoms of the 5-oxo-L-proline ligands, creating a stable chelate structure that mimics certain enzyme active sites. This complex is particularly interesting for researchers exploring metal-binding sites in metalloproteins, as it provides insights into zinc’s role in biological systems. Additionally, Bis(5-oxo-L-prolinato-N1,O2)zinc serves as a model compound for studying zinc’s interactions with amino acid derivatives, aiding in the design of zinc-based drugs and therapeutic agents.
CAS Number | 15454-75-8 |
Molecular Formula | C10H12N2O6Zn |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | zinc;(2S)-5-oxopyrrolidine-2-carboxylate |
InChI | InChI=1S/2C5H7NO3.Zn/c2*7-4-2-1-3(6-4)5(8)9;/h2*3H,1-2H2,(H,6,7)(H,8,9);/q;;+2/p-2/t2*3-;/m00./s1 |
InChIKey | OWVLYQRCCIEOPF-QHTZZOMLSA-L |
SMILES | C1CC(=O)NC1C(=O)[O-].C1CC(=O)NC1C(=O)[O-].[Zn+2] |