For research use only. Not for therapeutic Use.
Bis(benzyl diphenylphosphine) iminium chloride（Cat No.:M065068）, is a chemical compound often used as a reagent in organic synthesis. It acts as a versatile source of iminium ions, which can undergo reactions with nucleophiles to create various functionalized compounds. Its structure includes benzyl groups and diphenylphosphine, enhancing its reactivity and applicability in various transformations.
| Catalog Number | M065068 |
| CAS Number | 13291-46-8 |
| Molecular Formula | C18H15O3P |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | 2-diphenylphosphorylbenzene-1,4-diol |
| InChI | InChI=1S/C18H15O3P/c19-14-11-12-17(20)18(13-14)22(21,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,19-20H |
| InChIKey | LLOXZCFOAUCDAE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=C(C=CC(=C3)O)O |
