For research use only. Not for therapeutic Use.
Bis(benzylsulfanyl)methylsulfanylmethylbenzene（Cat No.:M283368） is a complex organic compound featuring multiple sulfur and benzene units. Its molecular formula is C22H22S3. This compound is used as a crosslinking agent in polymer chemistry, where it helps to improve the mechanical properties and stability of polymers. It is also utilized in organic synthesis as a building block to create more complex molecules. The presence of multiple sulfur and benzene units in its structure gives it unique reactivity and properties, making it valuable in various chemical processes and industries. Further research is ongoing to explore its full potential in material science and organic chemistry.
| Catalog Number | M283368 |
| CAS Number | 10606-38-9 |
| Molecular Formula | C22H22S3 |
| Purity | ≥95% |
| IUPAC Name | bis(benzylsulfanyl)methylsulfanylmethylbenzene |
| InChI | InChI=1S/C22H22S3/c1-4-10-19(11-5-1)16-23-22(24-17-20-12-6-2-7-13-20)25-18-21-14-8-3-9-15-21/h1-15,22H,16-18H2 |
| InChIKey | GTUTUZVJRAZDOO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC(SCC2=CC=CC=C2)SCC3=CC=CC=C3 |
