For research use only. Not for therapeutic Use.
Bis(cyclooctatetraene)iron(0)（Cat No.:M129996）, often abbreviated as (COT)2Fe(0), is an organometallic complex featuring an iron atom coordinated by two cyclooctatetraene ligands. This compound is commonly used in organometallic chemistry as a source of iron(0) for various synthetic applications, such as in catalysis and as a precursor to other organoiron compounds. The high purity grade of min. 98% ensures its suitability for research and industrial purposes, where precise control over the reaction conditions and product purity is essential. (COT)2Fe(0) is valued for its stability and unique reactivity in a variety of chemical transformations.
| Catalog Number | M129996 |
| CAS Number | 12184-52-0 |
| Synonyms | Bis(cyclooctatetraene)iron(0), min. 98% |
| Molecular Formula | C16H16Fe |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | cyclooctatetraene;iron |
| InChI | InChI=1S/2C8H8.Fe/c2*1-2-4-6-8-7-5-3-1;/h2*1-8H;/b2*2-1-,3-1?,4-2?,5-3-,6-4-,7-5?,8-6?,8-7-; |
| InChIKey | MXSLSXKBFNCQNV-MZLYQNCSSA-N |
| SMILES | C1=CC=CC=CC=C1.C1=CC=CC=CC=C1.[Fe] |
