For research use only. Not for therapeutic Use.
Bis(dichlorosilyl)methane（Cat No.:M077985）, a compound with the chemical formula (SiHCl2)2CH2, features two silyl groups (SiHCl2) attached to a central methane carbon atom. Synthesized through the reaction of chlorosilanes with lithium dimethylamide, it serves as a precursor in organosilicon chemistry, aiding in the creation of various silicon-based materials and polymers. Its structural versatility and reactivity make it valuable in the development of advanced materials, coatings, and pharmaceuticals.
| Catalog Number | M077985 |
| CAS Number | 18081-42-0 |
| Molecular Formula | CH2Cl4Si2 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| InChI | InChI=1S/CH2Cl4Si2/c2-6(3)1-7(4)5/h1H2 |
| InChIKey | MJDRMXBTLIZHHH-UHFFFAOYSA-N |
| SMILES | C([Si](Cl)Cl)[Si](Cl)Cl |
