For research use only. Not for therapeutic Use.
Bis[2-(2-butoxyethoxy)ethyl] adipate(Cat No.:M069188) is a chemical compound used primarily as a plasticizer in polymer formulations, particularly in polyvinyl chloride (PVC) applications. Its molecular structure comprises two adipate groups linked to a central backbone of two 2-(2-butoxyethoxy)ethyl moieties. As a plasticizer, it imparts flexibility, durability, and resilience to PVC products, enhancing their mechanical properties and performance characteristics. Moreover, this compound exhibits low volatility and excellent compatibility with PVC resins, ensuring long-term stability and durability of the final products. Its widespread use extends to various industries, including construction, automotive, and packaging, where flexible PVC materials are essential.
CAS Number | 141-17-3 |
Molecular Formula | C22H42O8 |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | bis[2-(2-butoxyethoxy)ethyl] hexanedioate |
InChI | InChI=1S/C22H42O8/c1-3-5-11-25-13-15-27-17-19-29-21(23)9-7-8-10-22(24)30-20-18-28-16-14-26-12-6-4-2/h3-20H2,1-2H3 |
InChIKey | SCABKEBYDRTODC-UHFFFAOYSA-N |
SMILES | CCCCOCCOCCOC(=O)CCCCC(=O)OCCOCCOCCCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |