For research use only. Not for therapeutic Use.
Bis(2-chlorophenyl)methanol(Cat No.:L007267), is a chemical compound composed of two chlorophenyl groups attached to a central methanol unit. This colorless solid is significant in the field of organic chemistry, often employed as a reagent in various synthetic processes and chemical transformations. Its unique structure and reactivity make it valuable in the creation of diverse organic compounds, including pharmaceuticals and agrochemicals. Researchers utilize this compound as a building block in the synthesis of complex molecules, contributing to advancements in drug development and chemical synthesis methodologies. Its applications highlight its importance in organic and medicinal chemistry research.
CAS Number | 6335-15-5 |
Molecular Formula | C13H10Cl2O |
Purity | ≥95% |
IUPAC Name | bis(2-chlorophenyl)methanol |
InChI | InChI=1S/C13H10Cl2O/c14-11-7-3-1-5-9(11)13(16)10-6-2-4-8-12(10)15/h1-8,13,16H |
InChIKey | YVZIETKZIJPLJM-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C(C2=CC=CC=C2Cl)O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |