For research use only. Not for therapeutic Use.
Bis(2-iodothiophen-3-yl)methanone is an organosulfur compound featuring two 2-iodothiophene rings attached to a central methanone (carbonyl) group. The iodine atoms on the thiophene rings increase the molecule’s reactivity, making it a useful precursor in organic synthesis, especially for creating complex aromatic systems and heterocycles. This compound’s structure and reactivity make it valuable in materials science, pharmaceuticals, and advanced research, particularly in studies involving halogenated thiophenes and the development of conductive or optoelectronic materials.
Catalog Number | L018547 |
CAS Number | 474416-61-0 |
Molecular Formula | C9H4I2OS2 |
Purity | ≥95% |
IUPAC Name | bis(2-iodothiophen-3-yl)methanone |
InChI | InChI=1S/C9H4I2OS2/c10-8-5(1-3-13-8)7(12)6-2-4-14-9(6)11/h1-4H |
InChIKey | XLSNWYDMCRRAIA-UHFFFAOYSA-N |
SMILES | C1=CSC(=C1C(=O)C2=C(SC=C2)I)I |