For research use only. Not for therapeutic Use.
Bis(4-isopropylphenyl)amine(CAT: L002414) is an aromatic amine featuring two 4-isopropylphenyl groups attached to a central nitrogen atom, making it a compound of interest in organic synthesis and materials science. The bulky isopropyl groups provide steric hindrance, enhancing the compound’s stability and making it suitable for use as a ligand or intermediate in synthesizing more complex organic molecules. Bis(4-isopropylphenyl)amine is commonly applied in the development of polymers, dyes, and other materials with unique electronic or optical properties. It is also explored in pharmaceutical research for designing compounds with potential bioactivity, particularly in studies focused on molecular rigidity and hydrophobic interactions.
CAS Number | 63451-41-2 |
Molecular Formula | C18H23N |
Purity | ≥95% |
IUPAC Name | 4-propan-2-yl-N-(4-propan-2-ylphenyl)aniline |
InChI | InChI=1S/C18H23N/c1-13(2)15-5-9-17(10-6-15)19-18-11-7-16(8-12-18)14(3)4/h5-14,19H,1-4H3 |
InChIKey | HFPMNRKCIPGSNW-UHFFFAOYSA-N |