For research use only. Not for therapeutic Use.
Bis(4-(naphthalen-2-yl)phenyl)amine (Cat.No:L003489) is a crucial chemical compound in materials science. Its distinct molecular structure, characterized by two naphthalene-phenyl groups, imparts notable electronic properties. This makes it a valuable component in the development of organic semiconductors and optoelectronic devices.
CAS Number | 1446448-94-7 |
Molecular Formula | C32H23N |
Purity | ≥95% |
IUPAC Name | 4-naphthalen-2-yl-N-(4-naphthalen-2-ylphenyl)aniline |
InChI | InChI=1S/C32H23N/c1-3-7-27-21-29(11-9-23(27)5-1)25-13-17-31(18-14-25)33-32-19-15-26(16-20-32)30-12-10-24-6-2-4-8-28(24)22-30/h1-22,33H |
InChIKey | YNKYZLVAYQLGIE-UHFFFAOYSA-N |
SMILES | C1=CC=C2C=C(C=CC2=C1)C3=CC=C(C=C3)NC4=CC=C(C=C4)C5=CC6=CC=CC=C6C=C5 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |