For research use only. Not for therapeutic Use.
Bisandrographolide C(CAT: M131816) is a diterpenoid compound isolated from the medicinal plant Andrographis paniculata, commonly known for its traditional use in treating various ailments, including infections and inflammation. Bisandrographolide C has gained attention in research for its potential anti-inflammatory, antiviral, and anticancer properties. It exhibits biological activity by modulating immune responses and inhibiting key pathways involved in inflammation and tumor growth. Studies have also explored its ability to inhibit viral replication, making it a candidate for antiviral drug development. As a bioactive natural product, bisandrographolide C continues to be studied for its therapeutic potential in modern medicine.
Catalog Number | M131816 |
CAS Number | 160498-02-2 |
Synonyms | Bisandrographolide C |
Molecular Formula | C40H56O8 |
Purity | 98% |
Target | Neuronal Signaling |
Appearance | Solid powder |
Storage | -20°C |
IUPAC Name | 4-[(E)-2-[(1R,4aS,5R,6R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-2-[2-[(1R,4aS,5R,6R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(5-oxo-2H-furan-4-yl)ethyl]-2H-furan-5-one |
InChI | InChI=1S/C40H56O8/c1-23-7-11-31-37(3,16-13-33(43)39(31,5)21-41)28(23)10-9-25-19-30(48-35(25)45)27(26-15-18-47-36(26)46)20-29-24(2)8-12-32-38(29,4)17-14-34(44)40(32,6)22-42/h9-10,15,19,27-34,41-44H,1-2,7-8,11-14,16-18,20-22H2,3-6H3/b10-9+/t27?,28-,29-,30?,31+,32+,33-,34-,37+,38+,39+,40+/m1/s1 |
InChIKey | WQHWOZANSOUSAY-LZBAHHAZSA-N |
SMILES | CC12CCC(C(C1CCC(=C)C2CC(C3C=C(C(=O)O3)C=CC4C(=C)CCC5C4(CCC(C5(C)CO)O)C)C6=CCOC6=O)(C)CO)O |