For research use only. Not for therapeutic Use.
Bisindolylmaleimide III(Cat No.:R042648)is a selective and potent inhibitor of protein kinase C (PKC), an enzyme involved in various cellular processes, including cell proliferation, differentiation, and apoptosis. By inhibiting PKC, Bisindolylmaleimide III can modulate cellular signaling pathways, making it a valuable tool in research focused on cancer, cardiovascular diseases, and neurological disorders. It is commonly used in experimental studies to explore the role of PKC in disease mechanisms and to assess potential therapeutic interventions. Additionally, Bisindolylmaleimide III may have applications in drug discovery, particularly for diseases where PKC dysregulation plays a significant role.
CAS Number | 137592-43-9 |
Synonyms | 3-[1-(3-aminopropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
Molecular Formula | C23H20N4O2 |
Purity | ≥95% |
IUPAC Name | 3-[1-(3-aminopropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
InChI | InChI=1S/C23H20N4O2/c24-10-5-11-27-13-17(15-7-2-4-9-19(15)27)21-20(22(28)26-23(21)29)16-12-25-18-8-3-1-6-14(16)18/h1-4,6-9,12-13,25H,5,10-11,24H2,(H,26,28,29) |
InChIKey | APYXQTXFRIDSGE-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=CN2)C3=C(C(=O)NC3=O)C4=CN(C5=CC=CC=C54)CCCN |