For research use only. Not for therapeutic Use.
Bis(nonafluorobutyl)phosphinic acid (Cat No.:C000917) is an organophosphorus compound. It is a colorless to pale yellow liquid and belongs to the family of fluorinated phosphinic acids. This compound is used as a reagent and building block in organic synthesis, particularly in the production of various chemical compounds and specialty chemicals. It contains two nonafluorobutyl groups linked by a phosphinic acid group. Bis(nonafluorobutyl)phosphinic acid is a valuable reagent in fluorination reactions and other organic transformations.
| Catalog Number | C000917 |
| CAS Number | 52299-25-9 |
| Synonyms | P-Bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phosphinic Acid |
| Molecular Formula | C₈HF₁₈O₂P |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Appearance | White to Off-White Semi-Solid |
| Storage | -20°C, Hygroscopic |
| IUPAC Name | bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phosphinic acid |
| InChI | InChI=1S/C8HF18O2P/c9-1(10,5(17,18)19)3(13,14)7(23,24)29(27,28)8(25,26)4(15,16)2(11,12)6(20,21)22/h(H,27,28) |
| InChIKey | WAZIDHPTVNFDQG-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)P(=O)(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)O)(F)F)(C(F)(F)F)(F)F |
| Reference | Ignatyev, M., et al.: Ger. Offen., DE 102007058600 A1, 20090610 (2009) |
