Bisphenol A-¹³C₁₂ is an isotopically labeled form of Bisphenol A (BPA), where all 12 carbon atoms in the molecule are replaced with the carbon-13 isotope. This labeling makes it particularly useful in environmental, toxicological, and metabolic studies. The carbon-13 isotope allows for precise tracking and analysis using techniques like NMR spectroscopy and mass spectrometry, enabling researchers to study the distribution, metabolism, and excretion of BPA in biological systems. Despite the isotopic labeling, Bisphenol A-¹³C₁₂ retains the same chemical properties as the non-labeled compound, making it a valuable tool in research on BPA’s effects and behavior in the environment and organisms.
| Catalog Number | R011125 |
| CAS Number | 263261-65-0 |
| Synonyms | 4,4’-(1-Methylethylidene)bisphenol-13C12; 2,2-Bis(4-hydroxyphenyl)propane-13C12; (4,4’-Dihydroxydiphenyl)dimethylmethane-13C12; 4,4’-Isopropylidenediphenol-13C12; |
| Molecular Formula | C15H16O2 |
| Purity | 95% |
| Storage | 2°C to 8°C |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| InChI | InChI=1S/C15H16O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12/h3-10,16-17H,1-2H3/i3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1,11+1,12+1,13+1,14+1 |
| InChIKey | IISBACLAFKSPIT-ZGFLEIAISA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O |
