For research use only. Not for therapeutic Use.
Bisphenol F ethoxylate (2 EO/phenol) diacrylate（Cat No.:M022546） is a specialized chemical compound primarily used in the production of polymers and resins due to its excellent cross-linking capabilities. This compound is derived from bisphenol F, which is modified by adding two ethoxy groups per phenol unit and then further functionalized with acrylate groups. The presence of acrylate groups allows it to undergo rapid polymerization when exposed to UV light or heat, making it valuable in applications like coatings, adhesives, and dental composites.
| Catalog Number | M022546 |
| CAS Number | 120750-67-6 |
| Molecular Formula | C18H22O6 |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | ethane-1,2-diol;4-[(4-hydroxyphenyl)methyl]phenol;prop-2-enoic acid |
| InChI | InChI=1S/C13H12O2.C3H4O2.C2H6O2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;1-2-3(4)5;3-1-2-4/h1-8,14-15H,9H2;2H,1H2,(H,4,5);3-4H,1-2H2 |
| InChIKey | OTXNLBPVRKDFKX-UHFFFAOYSA-N |
| SMILES | C=CC(=O)O.C1=CC(=CC=C1CC2=CC=C(C=C2)O)O.C(CO)O |
