For research use only. Not for therapeutic Use.
Bis(phenylsulfonyl)sulfide(Cat No.:L047099)is an organosulfur compound used as a key intermediate in organic synthesis, particularly in the development of pharmaceuticals and advanced materials. This compound features two phenylsulfonyl groups attached to a central sulfur atom, giving it unique reactivity that is valuable for creating sulfur-containing molecules. It is often employed in the synthesis of sulfone and sulfoxide derivatives, which are important in medicinal chemistry for developing bioactive compounds. Its versatility and role in facilitating complex chemical transformations make it a crucial building block in research and industrial applications.
CAS Number | 4388-22-1 |
Molecular Formula | C12H10O4S3 |
Purity | ≥95% |
IUPAC Name | benzenesulfonylsulfanylsulfonylbenzene |
InChI | InChI=1S/C12H10O4S3/c13-18(14,11-7-3-1-4-8-11)17-19(15,16)12-9-5-2-6-10-12/h1-10H |
InChIKey | YQUSJUJNDKUWAM-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)S(=O)(=O)SS(=O)(=O)C2=CC=CC=C2 |