For research use only. Not for therapeutic Use.
Bis(pyridin-2-yl)methanamine is an organic compound featuring a methanamine core bonded to two pyridine rings at the 2-position. This structure imparts significant aromatic and electronic properties, making it valuable in coordination chemistry and organic synthesis. The compound may act as a ligand in metal complexes, enhancing catalytic activity or stability. Its potential applications extend to pharmaceuticals and agrochemicals, where it may exhibit biological activity. The unique combination of functionalities allows for various modifications and explorations in chemical research.
CAS Number | 58088-50-9 |
Molecular Formula | C11H11N3 |
Purity | ≥95% |
IUPAC Name | dipyridin-2-ylmethanamine |
InChI | InChI=1S/C11H11N3/c12-11(9-5-1-3-7-13-9)10-6-2-4-8-14-10/h1-8,11H,12H2 |
InChIKey | WHQWJVROPJNMEX-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)C(C2=CC=CC=N2)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |