For research use only. Not for therapeutic Use.
bisSP1 is an antibody agent conjugates linker[1]. bisSP1 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups.
| Catalog Number | I043381 |
| CAS Number | 2253947-15-6 |
| Synonyms | (2S)-6-amino-2-(3-azidopropanoylamino)-N-(3-azidopropyl)hexanamide |
| Molecular Formula | C12H23N9O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C12H23N9O2/c13-6-2-1-4-10(19-11(22)5-9-18-21-15)12(23)16-7-3-8-17-20-14/h10H,1-9,13H2,(H,16,23)(H,19,22)/t10-/m0/s1 |
| InChIKey | LRQNLHXWGRMZJY-JTQLQIEISA-N |
| SMILES | C(CCN)CC(C(=O)NCCCN=[N+]=[N-])NC(=O)CCN=[N+]=[N-] |
| Reference | [1]. Kyoji TSUCHIKAMA, et al. Linkers for antibody drug conjugates. Patent WO2018218004A1. |
