For research use only. Not for therapeutic Use.
bisSP1（Cat No.:I043381）is a bifunctional peptide inhibitor designed to target specific biological pathways. It has shown potential in modulating cellular processes by interfering with protein-protein interactions and enzymatic activities, making it a valuable tool in research related to cancer, inflammation, and neurodegenerative diseases. bisSP1’s unique structure allows it to bind with high affinity to its target proteins, offering specificity and reduced off-target effects. As a versatile inhibitor, bisSP1 holds promise for advancing therapeutic development in various disease areas by enabling precise modulation of molecular pathways.
| CAS Number | 2253947-15-6 |
| Synonyms | (2S)-6-amino-2-(3-azidopropanoylamino)-N-(3-azidopropyl)hexanamide |
| Molecular Formula | C12H23N9O2 |
| Purity | ≥95% |
| IUPAC Name | (2S)-6-amino-2-(3-azidopropanoylamino)-N-(3-azidopropyl)hexanamide |
| InChI | InChI=1S/C12H23N9O2/c13-6-2-1-4-10(19-11(22)5-9-18-21-15)12(23)16-7-3-8-17-20-14/h10H,1-9,13H2,(H,16,23)(H,19,22)/t10-/m0/s1 |
| InChIKey | LRQNLHXWGRMZJY-JTQLQIEISA-N |
| SMILES | C(CCN)C[C@@H](C(=O)NCCCN=[N+]=[N-])NC(=O)CCN=[N+]=[N-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
