For research use only. Not for therapeutic Use.
Bistratamide A(Cat No.:M018863) is a natural compound isolated from the marine ascidian Lissoclinum bistratum. It belongs to the class of cyclic peptides, known for their intricate ring structures and potent biological activities. Bistratamide A specifically contains unique amino acid residues that contribute to its bioactivity, which includes inhibiting protein synthesis within cells. This mode of action suggests potential applications in cancer therapy, as it can selectively target and inhibit the growth of tumor cells. Research on bistratamide A focuses on its potential as a lead compound for developing new anticancer drugs, leveraging its natural cytotoxic properties.
CAS Number | 120853-13-6 |
Synonyms | bistratamide A |
Molecular Formula | C27H34N6O4S2 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | (4S,7R,8S,11S,18S)-18-benzyl-7,11-dimethyl-4-propan-2-yl-6-oxa-13,20-dithia-3,10,17,22,23,24-hexazatetracyclo[17.2.1.15,8.112,15]tetracosa-5(24),12(23),19(22)-triene-2,9,16-trione |
InChI | InChI=1S/C27H34N6O4S2/c1-13(2)20-25-33-21(15(4)37-25)24(36)28-14(3)26-30-18(11-38-26)22(34)29-17(10-16-8-6-5-7-9-16)27-31-19(12-39-27)23(35)32-20/h5-9,13-15,17-21H,10-12H2,1-4H3,(H,28,36)(H,29,34)(H,32,35)/t14-,15+,17-,18?,19?,20-,21-/m0/s1 |
InChIKey | WNSIWZVQPOAVNY-XKYJWWAMSA-N |
SMILES | CC1C2C(=O)NC(C3=NC(CS3)C(=O)NC(C4=NC(CS4)C(=O)NC(C(=N2)O1)C(C)C)CC5=CC=CC=C5)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |