For research use only. Not for therapeutic Use.
BIX02188(CAT: I003216) is a selective inhibitor of the protein kinase MEK, which plays a key role in the mitogen-activated protein kinase (MAPK) signaling pathway. This pathway regulates various cellular processes, including cell growth, differentiation, and survival. By inhibiting the activity of MEK, BIX02188 can block the activation of downstream signaling pathways and inhibit the growth and proliferation of cancer cells. BIX02188 has shown promising results in preclinical studies, and it is currently being evaluated for its potential use in cancer therapy.
| Catalog Number | I003216 |
| CAS Number | 334949-59-6 |
| Synonyms | (3Z)-3-[[[3-[(dimethylamino)methyl]phenyl]amino]phenylmethylene]-2,3-dihydro-2-oxo-1H-indole-6-carboxamide |
| Molecular Formula | C25H24N4O2 |
| Purity | ≥95% |
| Target | MEK5 |
| Solubility | DMSO: ≥ 45 mg/mL |
| Storage | -20°C |
| IC50 | 4.3 nM |
| IUPAC Name | (3Z)-3-[[3-[(dimethylamino)methyl]anilino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxamide |
| InChI | InChI=1S/C25H24N4O2/c1-29(2)15-16-7-6-10-19(13-16)27-23(17-8-4-3-5-9-17)22-20-12-11-18(24(26)30)14-21(20)28-25(22)31/h3-14,27H,15H2,1-2H3,(H2,26,30)(H,28,31)/b23-22- |
| InChIKey | FSZPIAXLCCQFCM-FCQUAONHSA-N |
| SMILES | CN(C)CC1=CC(=CC=C1)NC(=C2C3=C(C=C(C=C3)C(=O)N)NC2=O)C4=CC=CC=C4 |
| Reference | <p style=/line-height:25px/> |
