For research use only. Not for therapeutic Use.
BIZ 114 (Example 11) is a fatty acid derivative and potent inhibits the TNF-α activated NF-κΒ pathway. BIZ 114 has the potential to prevent and / or treat ophthalmic disorders such as retinal degenerative disorders and ocular inflammatory diseases[1].
Polyunsaturated fatty acids and their metabolites are involved in many physiological and pathophysiological reactions and as such possess a range of important biological activities. They affect plasma lipids and lipid metabolism. They are incorporated into cell membranes where they influence different cell functions. They are also involved in inflammatory diseases and they also influence and control gene expression. The fatty acid derivatives have the potential for treatment and/or prevention of ophthalmic disorders, in particular retinal disorders such as age-related macular degeneration and diabetic retinopathy, and ocular inflammatory diseases[1].
Catalog Number | I016829 |
CAS Number | 2099120-74-6 |
Synonyms | 2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoxy]butanoic acid |
Molecular Formula | C24H40O3 |
Purity | ≥95% |
InChI | InChI=1S/C24H40O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27-23(4-2)24(25)26/h8-9,11-12,14-15,17-18,23H,3-7,10,13,16,19-22H2,1-2H3,(H,25,26)/b9-8-,12-11-,15-14-,18-17- |
InChIKey | JJBSGIKIKLMNBG-GKFVBPDJSA-N |
SMILES | CCCCCC=CCC=CCC=CCC=CCCCCOC(CC)C(=O)O |
Reference | [1]. Anne Kristin Holmeide. pid compounds and compositions and their opthalmic use. WO2017093732A1. |