For research use only. Not for therapeutic Use.
Bizelesin (NSC 615291; U-77779) is an AT-specific DNA alkylating agent that can generate DNA interstrand crosslinks, effectively inhibit DNA replication, and has potential anticancer activity[1].
Bizelesin (0-5 μM, 4 h) can cause DNA-specific damage by targeting the AT-rich DNA domain in human cancer cell CEM cells, thereby causing damage to cancer cells, and has potential cancer therapeutic potential[1]. Bizelesin (0-500 nM) causes a 50% inhibition of DNA synthesis at a concentration of 10 nM, compared to a 50% inhibition of RNA synthesis at a concentration of 160 nM, at concentrations as high as 200 nM no inhibition of protein synthesis is observed in BSC-1 cells[2].
| Catalog Number | R049020 |
| CAS Number | 129655-21-6 |
| Synonyms | 1,3-bis[2-[(8S)-8-(chloromethyl)-4-hydroxy-1-methyl-7,8-dihydro-3H-pyrrolo[3,2-e]indole-6-carbonyl]-1H-indol-5-yl]urea |
| Molecular Formula | C43H36Cl2N8O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C43H36Cl2N8O5/c1-19-15-46-39-33(54)11-31-37(35(19)39)23(13-44)17-52(31)41(56)29-9-21-7-25(3-5-27(21)50-29)48-43(58)49-26-4-6-28-22(8-26)10-30(51-28)42(57)53-18-24(14-45)38-32(53)12-34(55)40-36(38)20(2)16-47-40/h3-12,15-16,23-24,46-47,50-51,54-55H,13-14,17-18H2,1-2H3,(H2,48,49,58)/t23-,24-/m1/s1 |
| InChIKey | FONKWHRXTPJODV-DNQXCXABSA-N |
| SMILES | CC1=CNC2=C(C=C3C(=C12)C(CN3C(=O)C4=CC5=C(N4)C=CC(=C5)NC(=O)NC6=CC7=C(C=C6)NC(=C7)C(=O)N8CC(C9=C1C(=CNC1=C(C=C98)O)C)CCl)CCl)O |
| Reference | [1]. J M Woynarowski, et al. AT-rich islands in genomic DNA as a novel target for AT-specific DNA-reactive antitumor drugs. J Biol Chem. 2001 Nov 2;276(44):40555-66. [2]. J M Woynarowski, et al. Effects of bizelesin (U-77,779), a bifunctional alkylating minor groove binder, on replication of genomic and simian virus 40 DNA in BSC-1 cells. Biochim Biophys Acta. 1997 Jul 17;1353(1):50-60. |
