For research use only. Not for therapeutic Use.
BL-2365 is a non-steroidal anti-inflammatory drug (NSAID).
| Catalog Number | I023471 |
| CAS Number | 31770-74-8 |
| Synonyms | BL 2365; BL2365; BL-2365 |
| Molecular Formula | C16H20O2 |
| Purity | 98% |
| Solubility | To be determined |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | Indan-1-carboxylic acid, (-)-5-cyclohexyl- |
| InChI | InChI=1S/C16H20O2/c17-16(18)15-9-7-13-10-12(6-8-14(13)15)11-4-2-1-3-5-11/h6,8,10-11,15H,1-5,7,9H2,(H,17,18)/t15-/m0/s1 |
| InChIKey | BKEWDCUQDVDPHC-HNNXBMFYSA-N |
| SMILES | OC(=O)[C@H]1CCc2cc(ccc12)C3CCCCC3 |
| Reference | 1. Fleming JS, Bierwagen ME, Campbell JA, King SP. The effect of a new anti-inflammatory agent (5-cyclohexylindan-1-carboxylic acid (BL-2365)) on platelet aggregation. Arch Int Pharmacodyn Ther. 1972 Sep;199(1):164-71. PMID: 5072183. |
