For research use only. Not for therapeutic Use.
(-)-Blebbistatin (CAT: I005143) is a small molecule inhibitor commonly used in cell biology and pharmacological research. It is known for its selective inhibition of non-muscle myosin II ATPase activity, leading to the disruption of actin-myosin interactions. (-)-Blebbistatin has been widely utilized to study cellular processes that rely on actomyosin contractilities, such as cell motility, cytokinesis, and muscle contraction. It has also been used in various experimental models to investigate the role of non-muscle myosin II in developmental processes, cell migration, and tissue morphogenesis. (-)-Blebbistatin is a valuable tool compound for understanding the mechanisms underlying actomyosin dynamics and has potential applications in the development of therapeutic strategies targeting diseases involving aberrant myosin function.
| Catalog Number | I005143 |
| CAS Number | 856925-71-8 |
| Synonyms | (S)-3a-hydroxy-6-methyl-1-phenyl-3,3a-dihydro-1H-pyrrolo[2,3-b]quinolin-4(2H)-one |
| Molecular Formula | C₁₈H₁₆N₂O₂ |
| Purity | ≥95% |
| Target | Myosin |
| Solubility | DMSO: ≥ 31 mg/mL |
| Storage | Store at -20°C |
| IC50 | 0.5 - 5 μM |
| InChI | InChI=1S/C18H16N2O2/c1-12-7-8-15-14(11-12)16(21)18(22)9-10-20(17(18)19-15)13-5-3-2-4-6-13/h2-8,11,22H,9-10H2,1H3/t18-/m1/s1 |
| InChIKey | LZAXPYOBKSJSEX-GOSISDBHSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C3C(C2=O)(CCN3C4=CC=CC=C4)O |
| Reference | 1: Fedorov VV, Lozinsky IT, Sosunov EA, Anyukhovsky EP, Rosen MR, Balke CW, <br> <br> <br> 5: Duxbury MS, Ashley SW, Whang EE. Inhibition of pancreatic adenocarcinoma |
