For research use only. Not for therapeutic Use.
BMK glycidyl acid (Cat. No: R066618) is an analytical reference standard and is considered to be a precursor for the production of phenylacetone. It can be used as pharmaceutical intermediate for scientific research.
| CAS Number | 25547-51-7 |
| Synonyms | 2-methyl-3-phenyl-2-oxiranecarboxylic acid |
| Molecular Formula | C10H10O3 |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C10H10O3/c1-10(9(11)12)8(13-10)7-5-3-2-4-6-7/h2-6,8H,1H3,(H,11,12) |
| InChIKey | UPEAOFCHTFWNFG-UHFFFAOYSA-N |
| SMILES | OC(C1(C)C(O1)C2=CC=CC=C2)=O |
| Reference | 1.Collins, M.,Heagney, A.,Cordaro, F., et al. Methyl 3-[3/’,4/’-(methylenedioxy)phenyl]-2-methyl glycidate: An ecstasy precursor seized in Sydney, Australia. J.Forensic Sci. 52(4), 898-903 (2016). |
