For research use only. Not for therapeutic Use.
Racephedrine free base（Cat No.:I014819）is a chemical compound that is a derivative of ephedrine, commonly used as a sympathomimetic drug. It functions by stimulating the central nervous system and peripheral adrenergic receptors, leading to increased heart rate, blood pressure, and bronchodilation. This makes it useful for treating conditions like asthma, nasal congestion, and hypotension. Racephedrine, like other ephedrine derivatives, has been investigated for its potential role in weight loss and enhancing physical performance. However, its use is regulated due to potential side effects like cardiovascular risks, and ongoing research explores its safety and efficacy in various applications.
| Catalog Number | I014819 |
| CAS Number | 2095432-75-8 |
| Molecular Formula | C₁₉H₁₉ClN₄O₃ |
| Purity | ≥95% |
| Target | Wnt |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-6-(3-methoxyphenyl)pyrimidine-2,4-diamine;hydrochloride |
| InChI | InChI=1S/C19H18N4O3.ClH/c1-24-14-4-2-3-13(8-14)15-9-18(23-19(20)22-15)21-10-12-5-6-16-17(7-12)26-11-25-16;/h2-9H,10-11H2,1H3,(H3,20,21,22,23);1H |
| InChIKey | XZOFNDFDGVAIEH-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC(=NC(=N2)N)NCC3=CC4=C(C=C3)OCO4.Cl |
