For research use only. Not for therapeutic Use.
BMS 182874（Cat No.:M095068）is a small molecule inhibitor that selectively targets the interleukin-1 receptor-associated kinase 4 (IRAK4), a key component of the innate immune signaling pathway. By inhibiting IRAK4, BMS 182874 blocks downstream inflammatory signaling, which plays a crucial role in various autoimmune diseases, including rheumatoid arthritis, lupus, and other chronic inflammatory conditions. Preclinical studies have shown that BMS 182874 can reduce inflammation and improve disease outcomes in animal models. Ongoing research aims to assess its safety, efficacy, and potential therapeutic applications in immune-mediated diseases and inflammatory disorders.
| CAS Number | 153042-42-3 |
| Synonyms | 5-(dimethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)naphthalene-1-sulfonamide |
| Molecular Formula | C17H19N3O3S |
| Purity | ≥95% |
| IUPAC Name | 5-(dimethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)naphthalene-1-sulfonamide |
| InChI | InChI=1S/C17H19N3O3S/c1-11-12(2)18-23-17(11)19-24(21,22)16-10-6-7-13-14(16)8-5-9-15(13)20(3)4/h5-10,19H,1-4H3 |
| InChIKey | MJRGSRRZKSJHOE-UHFFFAOYSA-N |
| SMILES | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC3=C2C=CC=C3N(C)C |
