For research use only. Not for therapeutic Use.
Nuclear retinoic acid receptor (RAR-γ) agonist; its more active (R)-(+)-enantiomer is BMS 270394 (Axon 1173)
| Catalog Number | M044271 |
| CAS Number | 185629-22-5 |
| Molecular Formula | C23H26FNO4 |
| Purity | ≥95% |
| IUPAC Name | 3-fluoro-4-[[2-hydroxy-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)acetyl]amino]benzoic acid |
| InChI | InChI=1S/C23H26FNO4/c1-22(2)9-10-23(3,4)16-11-13(5-7-15(16)22)19(26)20(27)25-18-8-6-14(21(28)29)12-17(18)24/h5-8,11-12,19,26H,9-10H2,1-4H3,(H,25,27)(H,28,29) |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)C(C(=O)NC3=C(C=C(C=C3)C(=O)O)F)O)(C)C)C |
| Reference | B P Klaholz et al. Enantiomer Discrimination Illustrated by High-Resolution Crystal Structures of the Human Nuclear Receptor hRARγ. Proc. Natl. Acad. Sci. USA. 2000, 97(12), 6322–6327. |
