For research use only. Not for therapeutic Use.
BMS-192364（Cat No.:I003223）is an investigational small molecule compound developed by Bristol Myers Squibb for the treatment of various cancers. It is a potent and selective inhibitor of a key enzyme involved in tumor cell proliferation and survival. By targeting this enzyme, BMS-192364 aims to disrupt critical pathways that allow cancer cells to grow and evade cell death. Preclinical studies have shown promising antitumor activity, and ongoing clinical trials are assessing its safety, efficacy, and potential to enhance the effectiveness of other cancer treatments, including chemotherapy and immunotherapy.
| CAS Number | 202822-21-7 |
| Synonyms | 2-(5-chloro-2-hydroxyphenyl)-5-[4-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-one |
| Molecular Formula | C15H9ClF3N3O2 |
| Purity | ≥95% |
| IUPAC Name | 2-(5-chloro-2-hydroxyphenyl)-5-[4-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-one |
| InChI | InChI=1S/C15H9ClF3N3O2/c16-10-5-6-12(23)11(7-10)22-14(24)20-13(21-22)8-1-3-9(4-2-8)15(17,18)19/h1-7,23H,(H,20,21,24) |
| InChIKey | XNRWPJIJOVVQRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN(C(=O)N2)C3=C(C=CC(=C3)Cl)O)C(F)(F)F |
