For research use only. Not for therapeutic Use.
BMS-195270（Cat No.:I004421）is an investigational small molecule developed by Bristol Myers Squibb for the treatment of various cancers. It is a selective inhibitor of a key enzyme involved in the regulation of cancer cell growth, survival, and metastasis. By targeting specific signaling pathways, BMS-195270 aims to disrupt tumor cell proliferation and enhance the effectiveness of other cancer treatments. Preclinical studies have shown promising results, particularly in cancers resistant to traditional therapies. Clinical trials are ongoing to evaluate its safety, efficacy, and potential as a targeted therapy for multiple types of cancer.
| CAS Number | 202822-23-9 |
| Synonyms | 2-(5-chloro-2-hydroxyphenyl)-5-[2-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-one |
| Molecular Formula | C15H9ClF3N3O2 |
| Purity | ≥95% |
| IUPAC Name | 2-(5-chloro-2-hydroxyphenyl)-5-[2-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-one |
| InChI | InChI=1S/C15H9ClF3N3O2/c16-8-5-6-12(23)11(7-8)22-14(24)20-13(21-22)9-3-1-2-4-10(9)15(17,18)19/h1-7,23H,(H,20,21,24) |
| InChIKey | PHWHYZMFGGOJEU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN(C(=O)N2)C3=C(C=CC(=C3)Cl)O)C(F)(F)F |
