For research use only. Not for therapeutic Use.
BMS-195614 (BMS 614) is a neutral RARα-selective antagonist with a Ki of 2.5 nM[1].
| Catalog Number | I004603 |
| CAS Number | 182135-66-6 |
| Synonyms | 4-[(5,5-dimethyl-8-quinolin-3-yl-6H-naphthalene-2-carbonyl)amino]benzoic acid |
| Molecular Formula | C29H24N2O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C29H24N2O3/c1-29(2)14-13-23(21-15-19-5-3-4-6-26(19)30-17-21)24-16-20(9-12-25(24)29)27(32)31-22-10-7-18(8-11-22)28(33)34/h3-13,15-17H,14H2,1-2H3,(H,31,32)(H,33,34) |
| InChIKey | WGLMBRZXZDAQHP-UHFFFAOYSA-N |
| SMILES | CC1(CC=C(C2=C1C=CC(=C2)C(=O)NC3=CC=C(C=C3)C(=O)O)C4=CC5=CC=CC=C5N=C4)C |
| Reference | [1]. Géhin M, et al. Structural basis for engineering of retinoic acid receptor isotype-selective agonists and antagonists. Chem Biol. 1999;6(8):519-529. |
