For research use only. Not for therapeutic Use.
BMS-262084(CAT: I004444) is a potent, selective, and irreversible inhibitor of factor XIa, an enzyme crucial to the intrinsic pathway of the blood coagulation cascade. By inhibiting factor XIa, BMS-262084 disrupts the formation of blood clots (thrombi) without significantly impairing normal hemostasis, making it a promising candidate for anticoagulation therapy. Its high selectivity for factor XIa is of particular interest in reducing the risk of thromboembolic conditions, such as deep vein thrombosis, stroke, and venous thromboembolism, while minimizing the bleeding risks associated with traditional anticoagulants. Research into BMS-262084 continues to explore its potential in safer, targeted anticoagulant therapies.
| CAS Number | 253174-92-4 |
| Synonyms | (2S,3R)-1-[4-(tert-butylcarbamoyl)piperazine-1-carbonyl]-3-[3-(diaminomethylideneamino)propyl]-4-oxoazetidine-2-carboxylic acid |
| Molecular Formula | C18H31N7O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C18H31N7O5/c1-18(2,3)22-16(29)23-7-9-24(10-8-23)17(30)25-12(14(27)28)11(13(25)26)5-4-6-21-15(19)20/h11-12H,4-10H2,1-3H3,(H,22,29)(H,27,28)(H4,19,20,21)/t11-,12+/m1/s1 |
| InChIKey | MFTQITSPGQORDA-NEPJUHHUSA-N |
| SMILES | CC(C)(C)NC(=O)N1CCN(CC1)C(=O)N2C(C(C2=O)CCCN=C(N)N)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
