For research use only. Not for therapeutic Use.
BMS-265246(Cat No.:I004172)is a selective inhibitor of the enzyme phosphatidylinositol 3-kinase (PI3K), particularly targeting the p110α isoform. By inhibiting PI3K, BMS-265246 disrupts key signaling pathways involved in cell growth, survival, and metabolism, making it a promising candidate in cancer research. Its potential therapeutic applications include treating various malignancies, especially those with aberrant PI3K signaling. Preclinical studies have shown efficacy in reducing tumor growth and enhancing the effects of other anticancer agents. Ongoing research aims to further elucidate its safety profile and optimal use in combination therapies for improved cancer treatment outcomes.
Catalog Number | I004172 |
CAS Number | 582315-72-8 |
Synonyms | (4-butoxy-1H-pyrazolo[3,4-b]pyridin-5-yl)-(2,6-difluoro-4-methylphenyl)methanone |
Molecular Formula | C18H17F2N3O2 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | DMSO 20 mg/ml; Water <1 mg/ml |
Storage | 3 years -20℃ powder |
IC50 | 6 nM(for CDK1/cyclin B); 9 nM(for CDK2/cyclin E) |
IUPAC Name | (4-butoxy-2H-pyrazolo[3,4-b]pyridin-5-yl)-(2,6-difluoro-4-methylphenyl)methanone |
InChI | InChI=1S/C18H17F2N3O2/c1-3-4-5-25-17-11(8-21-18-12(17)9-22-23-18)16(24)15-13(19)6-10(2)7-14(15)20/h6-9H,3-5H2,1-2H3,(H,21,22,23) |
InChIKey | SCFMWQIQBVZOQR-UHFFFAOYSA-N |
SMILES | CCCCOC1=C(C=NC2=NNC=C12)C(=O)C3=C(C=C(C=C3F)C)F |
Reference | <p style=/line-height:25px/> |