For research use only. Not for therapeutic Use.
BMS-433771 dihydrochloride hydrate(Cat No.:I041323)is a potent small molecule inhibitor designed to target and inhibit the activity of Janus kinase 3 (JAK3), a key enzyme involved in immune cell signaling. By selectively inhibiting JAK3, BMS-433771 aims to modulate the immune response, making it a promising candidate for treating autoimmune diseases and inflammatory conditions such as rheumatoid arthritis and psoriasis. Preclinical studies have shown that BMS-433771 can effectively reduce inflammation and immune system overactivation, potentially offering a targeted therapeutic approach with fewer side effects compared to broader immunosuppressive therapies.
CAS Number | 543700-67-0 |
Synonyms | 1-cyclopropyl-3-[[1-(4-hydroxybutyl)benzimidazol-2-yl]methyl]imidazo[4,5-c]pyridin-2-one;hydrate;dihydrochloride |
Molecular Formula | C21H27Cl2N5O3 |
Purity | ≥95% |
IUPAC Name | 1-cyclopropyl-3-[[1-(4-hydroxybutyl)benzimidazol-2-yl]methyl]imidazo[4,5-c]pyridin-2-one;hydrate;dihydrochloride |
InChI | InChI=1S/C21H23N5O2.2ClH.H2O/c27-12-4-3-11-24-17-6-2-1-5-16(17)23-20(24)14-25-19-13-22-10-9-18(19)26(21(25)28)15-7-8-15;;;/h1-2,5-6,9-10,13,15,27H,3-4,7-8,11-12,14H2;2*1H;1H2 |
InChIKey | DMSGBVAHVFUZMJ-UHFFFAOYSA-N |
SMILES | C1CC1N2C3=C(C=NC=C3)N(C2=O)CC4=NC5=CC=CC=C5N4CCCCO.O.Cl.Cl |