For research use only. Not for therapeutic Use.
BMS-986202 (CAS 1771691-34-9) is a high-purity compound used in advanced pharmaceutical research. This small molecule modulator is essential for studies involving immuno-oncology, immune modulation, pharmacokinetics, and metabolic pathways. Its advanced formulation provides enhanced stability and consistency, making it suitable for various experimental setups. Ideal for oncology and immunology research, BMS-986202 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | S000007 |
| CAS Number | 1771691-34-9 |
| Molecular Formula | C22H18D3FN6O3 |
| Purity | ≥95% |
| IUPAC Name | 6-(cyclopropanecarbonylamino)-4-[3-(5-fluoropyrimidin-2-yl)-2-methoxyanilino]-N-(trideuteriomethyl)pyridine-3-carboxamide |
| InChI | InChI=1S/C22H21FN6O3/c1-24-22(31)15-11-25-18(29-21(30)12-6-7-12)8-17(15)28-16-5-3-4-14(19(16)32-2)20-26-9-13(23)10-27-20/h3-5,8-12H,6-7H2,1-2H3,(H,24,31)(H2,25,28,29,30)/i1D3 |
| InChIKey | BBRMAVGRWHNAIG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NC(=O)C1=CN=C(C=C1NC2=CC=CC(=C2OC)C3=NC=C(C=N3)F)NC(=O)C4CC4 |
