For research use only. Not for therapeutic Use.
BMS-641(CAT: I004614) is a selective inhibitor primarily used in biochemical and pharmacological research. It has shown significant activity in modulating specific enzymatic or receptor-mediated pathways, making it valuable for the study of disease mechanisms and potential therapeutic interventions. This compound is utilized in the development of targeted therapies, especially in areas like oncology, immunology, or metabolic disorders. With its high specificity and reliability, BMS-641 supports researchers in exploring innovative strategies for drug discovery and advancing knowledge of molecular pathways.
| Catalog Number | I004614 |
| CAS Number | 369364-50-1 |
| Synonyms | BMS641; BMS-641; BMS 641.;3-chloro-4-[(E)-2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethenyl]benzoic acid |
| Molecular Formula | C27H23ClO2 |
| Purity | ≥95% |
| Target | Vitamin D Related/Nuclear Receptor |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4 °C for short term or -20 °C for long term |
| IUPAC Name | 3-chloro-4-[(E)-2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethenyl]benzoic acid |
| InChI | InChI=1S/C27H23ClO2/c1-27(2)15-14-22(19-6-4-3-5-7-19)23-16-18(9-13-24(23)27)8-10-20-11-12-21(26(29)30)17-25(20)28/h3-14,16-17H,15H2,1-2H3,(H,29,30)/b10-8+ |
| InChIKey | FRTYVAKGTFXRNY-CSKARUKUSA-N |
| SMILES | O=C(O)C1=CC=C(/C=C/C2=CC=C3C(C)(C)CC=C(C4=CC=CC=C4)C3=C2)C(Cl)=C1 |
