For research use only. Not for therapeutic Use.
BNTA is a novel inhibitor of osteoarthritis development, promoting cartilage extracellular matrix (ECM) generation, inducing SOD3 expression and superoxide anion elimination in osteoarthritic chondrocyte culture.
| Catalog Number | I023589 |
| Synonyms | BNTA |
| Molecular Formula | C17H13NaO4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | N-(2-Bromo-4-(phenylsulfonyl)thiophen-3-yl)-2-chlorobenzamide |
| InChI | InChI=1S/C17H14O4.Na/c1-21-16-9-5-4-8-14(16)15(18)11-10-12-6-2-3-7-13(12)17(19)20;/h2-11H,1H3,(H,19,20);/q;+1/p-1/b11-10+; |
| InChIKey | JCKWBPCGGVUJEV-ASTDGNLGSA-M |
| SMILES | O=C([O-])C1=CC=CC=C1/C=C/C(C2=CC=CC=C2OC)=O.[Na+] |
