BO-264（Cat No.:I016174） is a potent and orally active inhibitor of the transforming acidic coiled-coil 3 (TACC3) protein, with an IC50 of 188nM and a Kd of 1.5nM. BO-264 specifically targets the FGFR3-TACC3 fusion protein, blocking its function. It induces SAC-dependent mitotic arrest, DNA damage, and apoptosis, exhibiting antitumor activity. BO-264 is being investigated as a potential treatment for cancers that have the FGFR3-TACC3 fusion protein, such as bladder cancer and multiple myeloma.
| Catalog Number | I016174 |
| CAS Number | 2408648-20-2 |
| Molecular Formula | C₁₈H₁₉N₅O₃ |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 3-(4-methoxyphenyl)-N-(2-morpholin-4-ylpyrimidin-4-yl)-1,2-oxazol-5-amine |
| InChI | InChI=1S/C18H19N5O3/c1-24-14-4-2-13(3-5-14)15-12-17(26-22-15)20-16-6-7-19-18(21-16)23-8-10-25-11-9-23/h2-7,12H,8-11H2,1H3,(H,19,20,21) |
| InChIKey | WRCGBYNVBFVRTN-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NOC(=C2)NC3=NC(=NC=C3)N4CCOCC4 |
| Reference | [1]. Akbulut O, et al. A Highly Potent TACC3 Inhibitor as a Novel Anti-cancer Drug Candidate. Mol Cancer Ther. 2020 Mar 26. pii: molcanther.0957.2019. |
