For research use only. Not for therapeutic Use.
Boc-2,6-Dichloro-D-Phenylalanine(Cat No.:L003201)is a protected amino acid derivative, widely used in peptide synthesis and pharmaceutical research. Featuring a tert-butyloxycarbonyl (Boc) protecting group and two chlorine atoms at the 2 and 6 positions on the phenyl ring, this compound is crucial for constructing peptides with specific structural and functional properties. Its unique structure enhances reactivity and selectivity during synthesis, making it ideal for developing complex peptides and bioactive molecules. Boc-2,6-Dichloro-D-Phenylalanine is essential for advancing research in medicinal chemistry and drug discovery.
CAS Number | 261380-30-7 |
Molecular Formula | C14H17Cl2NO4 |
Purity | ≥95% |
IUPAC Name | (2R)-3-(2,6-dichlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
InChI | InChI=1S/C14H17Cl2NO4/c1-14(2,3)21-13(20)17-11(12(18)19)7-8-9(15)5-4-6-10(8)16/h4-6,11H,7H2,1-3H3,(H,17,20)(H,18,19)/t11-/m1/s1 |
InChIKey | YBKLZYRUNSCPAT-LLVKDONJSA-N |
SMILES | CC(C)(C)OC(=O)NC(CC1=C(C=CC=C1Cl)Cl)C(=O)O |