For research use only. Not for therapeutic Use.
BOC-3-aminobenzylalcohol is a protected amino alcohol featuring a tert-butyloxycarbonyl (BOC) group and a benzyl alcohol moiety. This compound is widely used in organic synthesis, particularly in the preparation of peptides and bioactive molecules. The BOC group serves to protect the amine during chemical reactions, allowing for selective transformations. Its structure makes it a valuable intermediate for developing pharmaceuticals and other biologically active compounds. Researchers utilize BOC-3-aminobenzylalcohol in various applications, including drug design and medicinal chemistry.
Catalog Number | M137149 |
CAS Number | 118684-31-4 |
Molecular Formula | C12H17NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | tert-butyl N-[3-(hydroxymethyl)phenyl]carbamate |
InChI | InChI=1S/C12H17NO3/c1-12(2,3)16-11(15)13-10-6-4-5-9(7-10)8-14/h4-7,14H,8H2,1-3H3,(H,13,15) |
InChIKey | OPMWQSDBBSURGY-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)NC1=CC=CC(=C1)CO |